ChemNet > CAS > 249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile
249278-33-9 3-[2,3-di(benzyloxy)phenyl]propanenitrile
| product Name |
3-[2,3-di(benzyloxy)phenyl]propanenitrile |
| CAS No |
249278-33-9 |
| Synonyms |
3-[2,3-bis(benzyloxy)phenyl]propanenitrile |
| Molecular Formula |
C23H21NO2 |
| Molecular Weight |
343.4183 |
| InChI |
InChI=1/C23H21NO2/c24-16-8-14-21-13-7-15-22(25-17-19-9-3-1-4-10-19)23(21)26-18-20-11-5-2-6-12-20/h1-7,9-13,15H,8,14,17-18H2 |
| Molecular Structure |
|
| Density |
1.138g/cm3 |
| Melting point |
200℃ |
| Boiling point |
525.9°C at 760 mmHg |
| Refractive index |
1.596 |
| Flash point |
174.5°C |
| Vapour Pressur |
3.75E-11mmHg at 25°C |
| Hazard Symbols |
Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|